| Attributes | Values |
|---|
| rdf:type
| |
| description
| - composto chimico (it)
- химическое соединение (ru)
- chemical compound (en)
- composé chimique (fr)
- תרכובת (he)
- kemisk forbindelse (da)
- compositum chemicum (la)
- chemische Verbindung (de)
- քիմիական միացություն (hy)
- chemická sloučenina (cs)
- chemická zlúčenina (sk)
- chemische verbinding (nl)
- kemia kombinaĵo (eo)
- związek chemiczny (pl)
- cheemesch Verbindung (lb)
- chemical compound (en-ca)
- chemical compound (en-gb)
- chemiese verbinding (af)
- chemische Verbindung (de-ch)
- component quimic (oc)
- compost químic (ca)
- composto químico (gl)
- composto químico (pt)
- composto químico (pt-br)
- compuesto quimico (an)
- compuestu químicu (ast)
- compus chimic (ro)
- kemiallinen yhdiste (fi)
- kjemisk forbindelse (nb)
- kjemisk sambinding (nn)
- komponim kimik (sq)
- konposatu kimiko (eu)
- senyawa kimia (id)
- ķīmisks savienojums (lv)
- хімічна сполука (uk)
- مركب كيميائي (ar)
- کیٖمیٲیی مُرَکَب (ks)
- রাসায়নিক যৌগ (bn)
- രാസസംയുക്തം (ml)
- compuesto químico (es)
- cheemsch Verbinnen (nds)
|
| rdfs:label
| |
| skos:prefLabel
| |
| name
| |
| isomeric SMILES
| |
| stereoisomer of
| |
| isomeric SMILES
| - C/C=C(/C)\C(=O)O[C@@H]1CCC2=CC(=O)[C@H](C[C@@]2([C@H]1C)C)C(=C)C
|
| stereoisomer of
| - petasin
- (3S)-3-Isopropenyl-4abeta,5beta-dimethyl-6alpha-(2-methylcrotonoyloxy)-2,3,4,4a,5,6,7,8-octahydronaphthalene-2-one
- [(1R,2R,7R,8aR)-1,8a-dimethyl-6-oxo-7-prop-1-en-2-yl-1,2,3,4,7,8-hexahydronaphthalen-2-yl] (E)-2-methylbut-2-enoate
|
| instance of
| |
| instance of
| |
| subclass of
| |
| subclass of
| |
| found in taxon
| |
| found in taxon
| |
| UniChem compound ID
| |
| CAS Registry Number
| |
| canonical SMILES
| |
| InChI
| |
| InChIKey
| |
| chemical formula
| |
| UNII
| |
| ChemSpider ID
| |
| PubChem CID
| |
| ChemSpider ID
| |
| PubChem CID
| |
| UniChem compound ID
| |
| CAS Registry Number
| |
| canonical SMILES
| - CC=C(C)C(=O)OC1CCC2=CC(=O)C(CC2(C1C)C)C(=C)C
|
| InChI
| - InChI=1S/C20H28O3/c1-7-13(4)19(22)23-18-9-8-15-10-17(21)16(12(2)3)11-20(15,6)14(18)5/h7,10,14,16,18H,2,8-9,11H2,1,3-6H3/b13-7-/t14-,16+,18+,20+/m0/s1
|
| InChIKey
| - ISTBXSFGFOYLTM-RSYQGVQLSA-N
|
| chemical formula
| |
| UNII
| |
| ChemSpider ID
| |
| PubChem CID
| |
| mass
| |
| mass
| |
| is about
of | |
| is stereoisomer of
of | - petasin
- (3S)-3-Isopropenyl-4abeta,5beta-dimethyl-6alpha-(2-methylcrotonoyloxy)-2,3,4,4a,5,6,7,8-octahydronaphthalene-2-one
- [(1R,2R,7R,8aR)-1,8a-dimethyl-6-oxo-7-prop-1-en-2-yl-1,2,3,4,7,8-hexahydronaphthalen-2-yl] (E)-2-methylbut-2-enoate
|
| is stereoisomer of
of | |
| is main subject
of | |
| is main subject
of | |
![[RDF Data]](/fct/images/sw-rdf-blue.png)
![[cxml]](/fct/images/cxml_doc.png)
![[csv]](/fct/images/csv_doc.png)
![[text]](/fct/images/ntriples_doc.png)
![[turtle]](/fct/images/n3turtle_doc.png)
![[ld+json]](/fct/images/jsonld_doc.png)
![[rdf+json]](/fct/images/json_doc.png)
![[rdf+xml]](/fct/images/xml_doc.png)
![[atom+xml]](/fct/images/atom_doc.png)
![[html]](/fct/images/html_doc.png)