| Attributes | Values |
|---|
| rdf:type
| |
| description
| - composto chimico (it)
- химическое соединение (ru)
- chemical compound (en)
- composé chimique (fr)
- תרכובת (he)
- kemisk forbindelse (da)
- compositum chemicum (la)
- chemische Verbindung (de)
- քիմիական միացություն (hy)
- chemická sloučenina (cs)
- chemická zlúčenina (sk)
- chemische verbinding (nl)
- kemia kombinaĵo (eo)
- związek chemiczny (pl)
- chemical compound (en-ca)
- chemical compound (en-gb)
- chemiese verbinding (af)
- chemische Verbindung (de-ch)
- component quimic (oc)
- compost químic (ca)
- composto químico (gl)
- composto químico (pt)
- composto químico (pt-br)
- compuesto quimico (an)
- compuestu químicu (ast)
- compus chimic (ro)
- kemiallinen yhdiste (fi)
- kjemisk forbindelse (nb)
- kjemisk sambinding (nn)
- komponim kimik (sq)
- konposatu kimiko (eu)
- senyawa kimia (id)
- ķīmisks savienojums (lv)
- хімічна сполука (uk)
- مركب كيميائي (ar)
- রাসায়নিক যৌগ (bn)
- compuesto químico (es)
- payvastagii khimiyaviy (tg-latn)
- пайвастагии химиявӣ (tg-cyrl)
- chemesch Verbindung (lb)
|
| rdfs:label
| - (2R,3S)-2-(2,4-Dihydroxyphenyl)-3,7-dihydroxy-5-methoxy-8-((R)-5-methyl-2-(prop-1-en-2-yl)hex-4-en-1-yl)chroman-4-one (en)
|
| skos:prefLabel
| - (2R,3S)-2-(2,4-Dihydroxyphenyl)-3,7-dihydroxy-5-methoxy-8-((R)-5-methyl-2-(prop-1-en-2-yl)hex-4-en-1-yl)chroman-4-one (en)
|
| name
| - (2R,3S)-2-(2,4-Dihydroxyphenyl)-3,7-dihydroxy-5-methoxy-8-((R)-5-methyl-2-(prop-1-en-2-yl)hex-4-en-1-yl)chroman-4-one (en)
|
| isomeric SMILES
| |
| stereoisomer of
| |
| isomeric SMILES
| - C=C(C)[C@H](CC=C(C)C)Cc1c(O)cc(OC)c2c1O[C@H](c1ccc(O)cc1O)[C@H](O)C2=O
|
| stereoisomer of
| - (2S,3R)-2-(2,4-dihydroxyphenyl)-3,7-dihydroxy-5-methoxy-8-[(2S)-5-methyl-2-prop-1-en-2-ylhex-4-enyl]-2,3-dihydrochromen-4-one
- CID 133612300
- (2R,3R)-2-(2,4-dihydroxyphenyl)-3,7-dihydroxy-5-methoxy-8-[(2R)-5-methyl-2-prop-1-en-2-ylhex-4-enyl]-2,3-dihydrochromen-4-one
- (2S,3R)-2-(2,4-dihydroxyphenyl)-3,7-dihydroxy-5-methoxy-8-[(2R)-5-methyl-2-prop-1-en-2-ylhex-4-enyl]-2,3-dihydrochromen-4-one
|
| instance of
| |
| instance of
| |
| subclass of
| |
| subclass of
| |
| found in taxon
| |
| found in taxon
| |
| UniChem compound ID
| |
| CAS Registry Number
| |
| canonical SMILES
| |
| InChI
| |
| InChIKey
| |
| chemical formula
| |
| PubChem CID
| |
| PubChem CID
| |
| UniChem compound ID
| |
| CAS Registry Number
| |
| canonical SMILES
| - O=C1C=2C(OC)=CC(O)=C(C2OC(C3=CC=C(O)C=C3O)C1O)CC(C(=C)C)CC=C(C)C
|
| InChI
| - InChI=1S/C26H30O7/c1-13(2)6-7-15(14(3)4)10-18-20(29)12-21(32-5)22-23(30)24(31)26(33-25(18)22)17-9-8-16(27)11-19(17)28/h6,8-9,11-12,15,24,26-29,31H,3,7,10H2,1-2,4-5H3/t15-,24-,26-/m1/s1
|
| InChIKey
| - QKEDJCCCNZWOBS-BZBXLLDXSA-N
|
| chemical formula
| |
| PubChem CID
| |
| mass
| |
| mass
| |
| is about
of | |
| is stereoisomer of
of | - (2S,3R)-2-(2,4-dihydroxyphenyl)-3,7-dihydroxy-5-methoxy-8-[(2S)-5-methyl-2-prop-1-en-2-ylhex-4-enyl]-2,3-dihydrochromen-4-one
- CID 133612300
- (2R,3R)-2-(2,4-dihydroxyphenyl)-3,7-dihydroxy-5-methoxy-8-[(2R)-5-methyl-2-prop-1-en-2-ylhex-4-enyl]-2,3-dihydrochromen-4-one
- (2S,3R)-2-(2,4-dihydroxyphenyl)-3,7-dihydroxy-5-methoxy-8-[(2R)-5-methyl-2-prop-1-en-2-ylhex-4-enyl]-2,3-dihydrochromen-4-one
|
| is stereoisomer of
of | |
| is main subject
of | |
![[RDF Data]](/fct/images/sw-rdf-blue.png)
![[cxml]](/fct/images/cxml_doc.png)
![[csv]](/fct/images/csv_doc.png)
![[text]](/fct/images/ntriples_doc.png)
![[turtle]](/fct/images/n3turtle_doc.png)
![[ld+json]](/fct/images/jsonld_doc.png)
![[rdf+json]](/fct/images/json_doc.png)
![[rdf+xml]](/fct/images/xml_doc.png)
![[atom+xml]](/fct/images/atom_doc.png)
![[html]](/fct/images/html_doc.png)