| Attributes | Values |
|---|
| rdf:type
| |
| description
| - groep van stereo-isomeren (nl)
- group of stereoisomers with the chemical formula C₃₂H₅₂O₂ (en)
- група стереоізомерів з хімічною формулою C₃₂H₅₂O₂ (uk)
|
| rdfs:label
| - Taraxasterol, acetate (en)
|
| skos:prefLabel
| - Taraxasterol, acetate (en)
|
| name
| - Taraxasterol, acetate (en)
|
| instance of
| |
| instance of
| |
| subclass of
| |
| subclass of
| |
| found in taxon
| |
| found in taxon
| |
| UniChem compound ID
| |
| Human Metabolome Database ID
| |
| canonical SMILES
| |
| InChI
| |
| InChIKey
| |
| chemical formula
| |
| PubChem CID
| |
| PubChem CID
| |
| UniChem compound ID
| |
| Human Metabolome Database ID
| |
| canonical SMILES
| - O=C(OC1CCC2(C)C(CCC3(C)C2CCC4C5C(C(=C)CCC5(C)CCC43C)C)C1(C)C)C
|
| InChI
| - InChI=1S/C32H52O2/c1-20-12-15-29(6)18-19-31(8)23(27(29)21(20)2)10-11-25-30(7)16-14-26(34-22(3)33)28(4,5)24(30)13-17-32(25,31)9/h21,23-27H,1,10-19H2,2-9H3
|
| InChIKey
| - SFEUTIOWNUGQMZ-UHFFFAOYSA-N
|
| chemical formula
| |
| PubChem CID
| |
| mass
| |
| mass
| |
| is about
of | |
| is subclass of
of | - [(3S,4aR,6aR,6aR,6bR,8aR,12S,12aR,14aS,14bR)-4,4,6a,6b,8a,12,14b-heptamethyl-11-methylidene-1,2,3,4a,5,6,6a,7,8,9,10,12,12a,13,14,14a-hexadecahydropicen-3-yl] acetate
- [(3R,4aS,6aR,6aR,6bR,8aR,12S,12aR,14aR,14bR)-4,4,6a,6b,8a,12,14b-heptamethyl-11-methylidene-1,2,3,4a,5,6,6a,7,8,9,10,12,12a,13,14,14a-hexadecahydropicen-3-yl] acetate
- [(3R,4aS,6aS,6aS,6bS,8aS,12S,12aR,14aS,14bS)-4,4,6a,6b,8a,12,14b-heptamethyl-11-methylidene-1,2,3,4a,5,6,6a,7,8,9,10,12,12a,13,14,14a-hexadecahydropicen-3-yl] acetate
- [(3S,4aS,6aS,6aR,6bR,8aR,12S,12aS,14aR,14bR)-4,4,6a,6b,8a,12,14b-heptamethyl-11-methylidene-1,2,3,4a,5,6,6a,7,8,9,10,12,12a,13,14,14a-hexadecahydropicen-3-yl] acetate
- [(3R,4aR,6aR,6aR,6bR,8aR,12S,12aS,14aR,14bR)-4,4,6a,6b,8a,12,14b-heptamethyl-11-methylidene-1,2,3,4a,5,6,6a,7,8,9,10,12,12a,13,14,14a-hexadecahydropicen-3-yl] acetate
- [(3S,4aR,6aR,6aR,6bR,8aR,12R,12aS,14aR,14bR)-4,4,6a,6b,8a,12,14b-heptamethyl-11-methylidene-1,2,3,4a,5,6,6a,7,8,9,10,12,12a,13,14,14a-hexadecahydropicen-3-yl] acetate
- [(3S,4aR,6aR,6aR,6bR,8aR,12S,12aS,14aR,14bR)-4,4,6a,6b,8a,12,14b-heptamethyl-11-methylidene-1,2,3,4a,5,6,6a,7,8,9,10,12,12a,13,14,14a-hexadecahydropicen-3-yl] acetate
|
| is subclass of
of | |
| is main subject
of | |
| is main subject
of | |
![[RDF Data]](/fct/images/sw-rdf-blue.png)
![[cxml]](/fct/images/cxml_doc.png)
![[csv]](/fct/images/csv_doc.png)
![[text]](/fct/images/ntriples_doc.png)
![[turtle]](/fct/images/n3turtle_doc.png)
![[ld+json]](/fct/images/jsonld_doc.png)
![[rdf+json]](/fct/images/json_doc.png)
![[rdf+xml]](/fct/images/xml_doc.png)
![[atom+xml]](/fct/images/atom_doc.png)
![[html]](/fct/images/html_doc.png)